C23H22ClFN2O8S — CID 155560601
ethyl 6-[(2-chloro-4-fluorophenyl)-[(4-nitrophenyl)methoxycarbonyl]sulfamoyl]cyclohexene-1-carboxylate (PubChem CID 155560601) has the molecular formula C23H22ClFN2O8S and a molecular weight of 540.95 g/mol. Its IUPAC name is ethyl 6-[(2-chloro-4-fluorophenyl)-[(4-nitrophenyl)methoxycarbonyl]sulfamoyl]cyclohexene-1-carboxylate.
| Compound Name | ethyl 6-[(2-chloro-4-fluorophenyl)-[(4-nitrophenyl)methoxycarbonyl]sulfamoyl]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 155560601 |
| Molecular Formula | C23H22ClFN2O8S |
| Molecular Weight | 540.95 g/mol |
| Exact Mass | 540.08 |
| IUPAC Name | ethyl 6-[(2-chloro-4-fluorophenyl)-[(4-nitrophenyl)methoxycarbonyl]sulfamoyl]cyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=CCCCC1S(=O)(=O)N(C(=O)OCc1ccc([N+](=O)[O-])cc1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C23H22ClFN2O8S/c1-2-34-22(28)18-5-3-4-6-21(18)36(32,33)26(20-12-9-16(25)13-19(20)24)23(29)35-14-15-7-10-17(11-8-15)27(30)31/h5,7-13,21H,2-4,6,14H2,1H3 |
| InChIKey | VBJFEFASEDZEIL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.95 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|