C18H19ClFNO7S — CID 89161874
(2-chloro-4-fluoro-N-(2-formylcyclohex-2-en-1-yl)sulfonylanilino)methyl [(2S)-1-oxopropan-2-yl] carbonate (PubChem CID 89161874) has the molecular formula C18H19ClFNO7S and a molecular weight of 447.87 g/mol. Its IUPAC name is (2-chloro-4-fluoro-N-(2-formylcyclohex-2-en-1-yl)sulfonylanilino)methyl [(2S)-1-oxopropan-2-yl] carbonate.
| Compound Name | (2-chloro-4-fluoro-N-(2-formylcyclohex-2-en-1-yl)sulfonylanilino)methyl [(2S)-1-oxopropan-2-yl] carbonate |
|---|---|
| PubChem CID | 89161874 |
| Molecular Formula | C18H19ClFNO7S |
| Molecular Weight | 447.87 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | (2-chloro-4-fluoro-N-(2-formylcyclohex-2-en-1-yl)sulfonylanilino)methyl [(2S)-1-oxopropan-2-yl] carbonate |
| SMILES | C[C@@H](C=O)OC(=O)OCN(c1ccc(F)cc1Cl)S(=O)(=O)C1CCCC=C1C=O |
| InChI | InChI=1S/C18H19ClFNO7S/c1-12(9-22)28-18(24)27-11-21(16-7-6-14(20)8-15(16)19)29(25,26)17-5-3-2-4-13(17)10-23/h4,6-10,12,17H,2-3,5,11H2,1H3/t12-,17?/m0/s1 |
| InChIKey | VVGYFXLSEKMWFY-WHUIICBVSA-N |
| XLogP | 2.99 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.87 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|