C29H33ClFN2O8S+ — CID 87617241
(2R)-2-benzyl-1-[(2-chloro-N-(2-ethoxycarbonylcyclohex-2-en-1-yl)sulfonyl-4-fluoroanilino)methyl]pyrrolidin-1-ium-1,2-dicarboxylic acid (PubChem CID 87617241) has the molecular formula C29H33ClFN2O8S+ and a molecular weight of 624.11 g/mol. Its IUPAC name is (2R)-2-benzyl-1-[(2-chloro-N-(2-ethoxycarbonylcyclohex-2-en-1-yl)sulfonyl-4-fluoroanilino)methyl]pyrrolidin-1-ium-1,2-dicarboxylic acid.
| Compound Name | (2R)-2-benzyl-1-[(2-chloro-N-(2-ethoxycarbonylcyclohex-2-en-1-yl)sulfonyl-4-fluoroanilino)methyl]pyrrolidin-1-ium-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 87617241 |
| Molecular Formula | C29H33ClFN2O8S+ |
| Molecular Weight | 624.11 g/mol |
| Exact Mass | 623.16 |
| IUPAC Name | (2R)-2-benzyl-1-[(2-chloro-N-(2-ethoxycarbonylcyclohex-2-en-1-yl)sulfonyl-4-fluoroanilino)methyl]pyrrolidin-1-ium-1,2-dicarboxylic acid |
| SMILES | CCOC(=O)C1=CCCCC1S(=O)(=O)N(C[N+]1(C(=O)O)CCC[C@@]1(Cc1ccccc1)C(=O)O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C29H32ClFN2O8S/c1-2-41-26(34)22-11-6-7-12-25(22)42(39,40)32(24-14-13-21(31)17-23(24)30)19-33(28(37)38)16-8-15-29(33,27(35)36)18-20-9-4-3-5-10-20/h3-5,9-11,13-14,17,25H,2,6-8,12,15-16,18-19H2,1H3,(H-,35,36,37,38)/p+1/t25?,29-,33?/m1/s1 |
| InChIKey | HTRUNUHMUPUFDS-UOCFFYQNSA-O |
| XLogP | 4.97 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.11 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|