C23H28N4O4 — CID 155561415
4-(3,3-dimethylbutanoyl)-N-(2-nitrophenyl)-2-phenylpiperazine-1-carboxamide (PubChem CID 155561415) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is 4-(3,3-dimethylbutanoyl)-N-(2-nitrophenyl)-2-phenylpiperazine-1-carboxamide.
| Compound Name | 4-(3,3-dimethylbutanoyl)-N-(2-nitrophenyl)-2-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 155561415 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 4-(3,3-dimethylbutanoyl)-N-(2-nitrophenyl)-2-phenylpiperazine-1-carboxamide |
| SMILES | CC(C)(C)CC(=O)N1CCN(C(=O)Nc2ccccc2[N+](=O)[O-])C(c2ccccc2)C1 |
| InChI | InChI=1S/C23H28N4O4/c1-23(2,3)15-21(28)25-13-14-26(20(16-25)17-9-5-4-6-10-17)22(29)24-18-11-7-8-12-19(18)27(30)31/h4-12,20H,13-16H2,1-3H3,(H,24,29) |
| InChIKey | KCCAKTLROAKJBV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|