C30H28N8O2+2 — CID 155564981
4-N,6-N-bis[(E)-(1-ethylquinolin-1-ium-6-yl)methylideneamino]pyrimidine-4,6-dicarboxamide (PubChem CID 155564981) has the molecular formula C30H28N8O2+2 and a molecular weight of 532.61 g/mol. Its IUPAC name is 4-N,6-N-bis[(E)-(1-ethylquinolin-1-ium-6-yl)methylideneamino]pyrimidine-4,6-dicarboxamide.
| Compound Name | 4-N,6-N-bis[(E)-(1-ethylquinolin-1-ium-6-yl)methylideneamino]pyrimidine-4,6-dicarboxamide |
|---|---|
| PubChem CID | 155564981 |
| Molecular Formula | C30H28N8O2+2 |
| Molecular Weight | 532.61 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 4-N,6-N-bis[(E)-(1-ethylquinolin-1-ium-6-yl)methylideneamino]pyrimidine-4,6-dicarboxamide |
| SMILES | CC[n+]1cccc2cc(/C=N/NC(=O)c3cc(C(=O)N/N=C/c4ccc5c(ccc[n+]5CC)c4)ncn3)ccc21 |
| InChI | InChI=1S/C30H26N8O2/c1-3-37-13-5-7-23-15-21(9-11-27(23)37)18-33-35-29(39)25-17-26(32-20-31-25)30(40)36-34-19-22-10-12-28-24(16-22)8-6-14-38(28)4-2/h5-20H,3-4H2,1-2H3/p+2/b33-18+,34-19+ |
| InChIKey | SJGRYHIULQOJNO-XNSDDFDOSA-P |
| XLogP | 2.93 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.61 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|