C20H20N8O2+2 — CID 155517293
4-N,6-N-bis[(E)-(1-methylpyridin-1-ium-4-yl)methylideneamino]pyrimidine-4,6-dicarboxamide (PubChem CID 155517293) has the molecular formula C20H20N8O2+2 and a molecular weight of 404.43 g/mol. Its IUPAC name is 4-N,6-N-bis[(E)-(1-methylpyridin-1-ium-4-yl)methylideneamino]pyrimidine-4,6-dicarboxamide.
| Compound Name | 4-N,6-N-bis[(E)-(1-methylpyridin-1-ium-4-yl)methylideneamino]pyrimidine-4,6-dicarboxamide |
|---|---|
| PubChem CID | 155517293 |
| Molecular Formula | C20H20N8O2+2 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 4-N,6-N-bis[(E)-(1-methylpyridin-1-ium-4-yl)methylideneamino]pyrimidine-4,6-dicarboxamide |
| SMILES | C[n+]1ccc(/C=N/NC(=O)c2cc(C(=O)N/N=C/c3cc[n+](C)cc3)ncn2)cc1 |
| InChI | InChI=1S/C20H18N8O2/c1-27-7-3-15(4-8-27)12-23-25-19(29)17-11-18(22-14-21-17)20(30)26-24-13-16-5-9-28(2)10-6-16/h3-14H,1-2H3/p+2 |
| InChIKey | XNSWWTNMUCWLJY-UHFFFAOYSA-P |
| XLogP | -0.35 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|