C18H14N8O2 — CID 158525802
4-N,6-N-bis(pyridin-4-ylmethylideneamino)pyrimidine-4,6-dicarboxamide (PubChem CID 158525802) has the molecular formula C18H14N8O2 and a molecular weight of 374.36 g/mol. Its IUPAC name is 4-N,6-N-bis(pyridin-4-ylmethylideneamino)pyrimidine-4,6-dicarboxamide.
| Compound Name | 4-N,6-N-bis(pyridin-4-ylmethylideneamino)pyrimidine-4,6-dicarboxamide |
|---|---|
| PubChem CID | 158525802 |
| Molecular Formula | C18H14N8O2 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 4-N,6-N-bis(pyridin-4-ylmethylideneamino)pyrimidine-4,6-dicarboxamide |
| SMILES | O=C(NN=Cc1ccncc1)c1cc(C(=O)NN=Cc2ccncc2)ncn1 |
| InChI | InChI=1S/C18H14N8O2/c27-17(25-23-10-13-1-5-19-6-2-13)15-9-16(22-12-21-15)18(28)26-24-11-14-3-7-20-8-4-14/h1-12H,(H,25,27)(H,26,28) |
| InChIKey | HMTOHVQHVLDUNU-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 134.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|