C11H11N5O — CID 841387
1-methyl-N-(pyridin-4-ylmethylideneamino)pyrazole-3-carboxamide (PubChem CID 841387) has the molecular formula C11H11N5O and a molecular weight of 229.24 g/mol. Its IUPAC name is 1-methyl-N-(pyridin-4-ylmethylideneamino)pyrazole-3-carboxamide.
| Compound Name | 1-methyl-N-(pyridin-4-ylmethylideneamino)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 841387 |
| Molecular Formula | C11H11N5O |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 1-methyl-N-(pyridin-4-ylmethylideneamino)pyrazole-3-carboxamide |
| SMILES | Cn1ccc(C(=O)NN=Cc2ccncc2)n1 |
| InChI | InChI=1S/C11H11N5O/c1-16-7-4-10(15-16)11(17)14-13-8-9-2-5-12-6-3-9/h2-8H,1H3,(H,14,17) |
| InChIKey | GLWDVRWHOISKJK-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|