C16H15BrN4O — CID 155565010
5-bromo-1'-pyridazin-3-ylspiro[1H-indole-3,4'-piperidine]-2-one (PubChem CID 155565010) has the molecular formula C16H15BrN4O and a molecular weight of 359.23 g/mol. Its IUPAC name is 5-bromo-1'-pyridazin-3-ylspiro[1H-indole-3,4'-piperidine]-2-one.
| Compound Name | 5-bromo-1'-pyridazin-3-ylspiro[1H-indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 155565010 |
| Molecular Formula | C16H15BrN4O |
| Molecular Weight | 359.23 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 5-bromo-1'-pyridazin-3-ylspiro[1H-indole-3,4'-piperidine]-2-one |
| SMILES | O=C1Nc2ccc(Br)cc2C12CCN(c1cccnn1)CC2 |
| InChI | InChI=1S/C16H15BrN4O/c17-11-3-4-13-12(10-11)16(15(22)19-13)5-8-21(9-6-16)14-2-1-7-18-20-14/h1-4,7,10H,5-6,8-9H2,(H,19,22) |
| InChIKey | ZIWXLKGOUPGBGO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |