C16H15ClN4O — CID 155536718
1'-(6-chloropyridazin-3-yl)spiro[1H-indole-3,4'-piperidine]-2-one (PubChem CID 155536718) has the molecular formula C16H15ClN4O and a molecular weight of 314.78 g/mol. Its IUPAC name is 1'-(6-chloropyridazin-3-yl)spiro[1H-indole-3,4'-piperidine]-2-one.
| Compound Name | 1'-(6-chloropyridazin-3-yl)spiro[1H-indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 155536718 |
| Molecular Formula | C16H15ClN4O |
| Molecular Weight | 314.78 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1'-(6-chloropyridazin-3-yl)spiro[1H-indole-3,4'-piperidine]-2-one |
| SMILES | O=C1Nc2ccccc2C12CCN(c1ccc(Cl)nn1)CC2 |
| InChI | InChI=1S/C16H15ClN4O/c17-13-5-6-14(20-19-13)21-9-7-16(8-10-21)11-3-1-2-4-12(11)18-15(16)22/h1-6H,7-10H2,(H,18,22) |
| InChIKey | WFVXEYWCYFBQQS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.78 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |