C19H19NO5S — CID 155567282
4-[(1E,4E)-5-(2,5-dimethoxyphenyl)-3-oxopenta-1,4-dienyl]benzenesulfonamide (PubChem CID 155567282) has the molecular formula C19H19NO5S and a molecular weight of 373.43 g/mol. Its IUPAC name is 4-[(1E,4E)-5-(2,5-dimethoxyphenyl)-3-oxopenta-1,4-dienyl]benzenesulfonamide.
| Compound Name | 4-[(1E,4E)-5-(2,5-dimethoxyphenyl)-3-oxopenta-1,4-dienyl]benzenesulfonamide |
|---|---|
| PubChem CID | 155567282 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 4-[(1E,4E)-5-(2,5-dimethoxyphenyl)-3-oxopenta-1,4-dienyl]benzenesulfonamide |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)/C=C/c2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C19H19NO5S/c1-24-17-9-12-19(25-2)15(13-17)6-8-16(21)7-3-14-4-10-18(11-5-14)26(20,22)23/h3-13H,1-2H3,(H2,20,22,23)/b7-3+,8-6+ |
| InChIKey | XEEUDXOCUODHOJ-ABHPZVFCSA-N |
| XLogP | 2.65 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|