C18H12N4S3 — CID 155568872
4-(4-methylphenyl)-2-prop-2-ynylsulfanyl-6-(1,3-thiazol-2-ylsulfanyl)pyrimidine-5-carbonitrile (PubChem CID 155568872) has the molecular formula C18H12N4S3 and a molecular weight of 380.52 g/mol. Its IUPAC name is 4-(4-methylphenyl)-2-prop-2-ynylsulfanyl-6-(1,3-thiazol-2-ylsulfanyl)pyrimidine-5-carbonitrile.
| Compound Name | 4-(4-methylphenyl)-2-prop-2-ynylsulfanyl-6-(1,3-thiazol-2-ylsulfanyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 155568872 |
| Molecular Formula | C18H12N4S3 |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 4-(4-methylphenyl)-2-prop-2-ynylsulfanyl-6-(1,3-thiazol-2-ylsulfanyl)pyrimidine-5-carbonitrile |
| SMILES | C#CCSc1nc(Sc2nccs2)c(C#N)c(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C18H12N4S3/c1-3-9-23-17-21-15(13-6-4-12(2)5-7-13)14(11-19)16(22-17)25-18-20-8-10-24-18/h1,4-8,10H,9H2,2H3 |
| InChIKey | MWSXYCQFZOWAIP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|