C12H6ClN3S2 — CID 87057442
4-chloro-2-prop-2-ynylsulfanyl-6-thiophen-3-ylpyrimidine-5-carbonitrile (PubChem CID 87057442) has the molecular formula C12H6ClN3S2 and a molecular weight of 291.79 g/mol. Its IUPAC name is 4-chloro-2-prop-2-ynylsulfanyl-6-thiophen-3-ylpyrimidine-5-carbonitrile.
| Compound Name | 4-chloro-2-prop-2-ynylsulfanyl-6-thiophen-3-ylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 87057442 |
| Molecular Formula | C12H6ClN3S2 |
| Molecular Weight | 291.79 g/mol |
| Exact Mass | 290.97 |
| IUPAC Name | 4-chloro-2-prop-2-ynylsulfanyl-6-thiophen-3-ylpyrimidine-5-carbonitrile |
| SMILES | C#CCSc1nc(Cl)c(C#N)c(-c2ccsc2)n1 |
| InChI | InChI=1S/C12H6ClN3S2/c1-2-4-18-12-15-10(8-3-5-17-7-8)9(6-14)11(13)16-12/h1,3,5,7H,4H2 |
| InChIKey | UZDLHWLZUDMCEM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.79 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|