C21H25N5O8 — CID 155569855
2-(3,4-dimethylanilino)-1-piperidin-1-ylethanone;2,4,6-trinitrophenol (PubChem CID 155569855) has the molecular formula C21H25N5O8 and a molecular weight of 475.46 g/mol. Its IUPAC name is 2-(3,4-dimethylanilino)-1-piperidin-1-ylethanone;2,4,6-trinitrophenol.
| Compound Name | 2-(3,4-dimethylanilino)-1-piperidin-1-ylethanone;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 155569855 |
| Molecular Formula | C21H25N5O8 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 2-(3,4-dimethylanilino)-1-piperidin-1-ylethanone;2,4,6-trinitrophenol |
| SMILES | Cc1ccc(NCC(=O)N2CCCCC2)cc1C.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H22N2O.C6H3N3O7/c1-12-6-7-14(10-13(12)2)16-11-15(18)17-8-4-3-5-9-17;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h6-7,10,16H,3-5,8-9,11H2,1-2H3;1-2,10H |
| InChIKey | FHJJSYCGROSUQR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 181.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|