C20H21BF2O4 — CID 155572073
1-[4-(2,4-difluorophenoxy)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone (PubChem CID 155572073) has the molecular formula C20H21BF2O4 and a molecular weight of 374.19 g/mol. Its IUPAC name is 1-[4-(2,4-difluorophenoxy)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone.
| Compound Name | 1-[4-(2,4-difluorophenoxy)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 155572073 |
| Molecular Formula | C20H21BF2O4 |
| Molecular Weight | 374.19 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 1-[4-(2,4-difluorophenoxy)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Oc2ccc(F)cc2F)c(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C20H21BF2O4/c1-12(24)13-6-8-17(25-18-9-7-14(22)11-16(18)23)15(10-13)21-26-19(2,3)20(4,5)27-21/h6-11H,1-5H3 |
| InChIKey | BPPJHDNPYAHHTE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.19 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|