C51H42N4 — CID 155576957
2-[3-(2-tert-butyl-6-methyl-3-pyridinyl)phenyl]-6-phenyl-4-[3-(10-phenylanthracen-9-yl)phenyl]-1,4-dihydro-1,3,5-triazine (PubChem CID 155576957) has the molecular formula C51H42N4 and a molecular weight of 710.93 g/mol. Its IUPAC name is 2-[3-(2-tert-butyl-6-methyl-3-pyridinyl)phenyl]-6-phenyl-4-[3-(10-phenylanthracen-9-yl)phenyl]-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2-[3-(2-tert-butyl-6-methyl-3-pyridinyl)phenyl]-6-phenyl-4-[3-(10-phenylanthracen-9-yl)phenyl]-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 155576957 |
| Molecular Formula | C51H42N4 |
| Molecular Weight | 710.93 g/mol |
| Exact Mass | 710.34 |
| IUPAC Name | 2-[3-(2-tert-butyl-6-methyl-3-pyridinyl)phenyl]-6-phenyl-4-[3-(10-phenylanthracen-9-yl)phenyl]-1,4-dihydro-1,3,5-triazine |
| SMILES | Cc1ccc(-c2cccc(C3=NC(c4cccc(-c5c6ccccc6c(-c6ccccc6)c6ccccc56)c4)N=C(c4ccccc4)N3)c2)c(C(C)(C)C)n1 |
| InChI | InChI=1S/C51H42N4/c1-33-29-30-40(47(52-33)51(2,3)4)36-21-15-23-38(31-36)49-53-48(35-19-9-6-10-20-35)54-50(55-49)39-24-16-22-37(32-39)46-43-27-13-11-25-41(43)45(34-17-7-5-8-18-34)42-26-12-14-28-44(42)46/h5-32,50H,1-4H3,(H,53,54,55) |
| InChIKey | ZSIIYATUBSFCBQ-UHFFFAOYSA-N |
| XLogP | 12.49 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.93 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|