C45H38N4 — CID 164758285
4-[3-(2-tert-butyl-6-methyl-3-pyridinyl)-5-phenanthren-9-ylphenyl]-2,6-diphenyl-1,4-dihydro-1,3,5-triazine (PubChem CID 164758285) has the molecular formula C45H38N4 and a molecular weight of 634.83 g/mol. Its IUPAC name is 4-[3-(2-tert-butyl-6-methyl-3-pyridinyl)-5-phenanthren-9-ylphenyl]-2,6-diphenyl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 4-[3-(2-tert-butyl-6-methyl-3-pyridinyl)-5-phenanthren-9-ylphenyl]-2,6-diphenyl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 164758285 |
| Molecular Formula | C45H38N4 |
| Molecular Weight | 634.83 g/mol |
| Exact Mass | 634.31 |
| IUPAC Name | 4-[3-(2-tert-butyl-6-methyl-3-pyridinyl)-5-phenanthren-9-ylphenyl]-2,6-diphenyl-1,4-dihydro-1,3,5-triazine |
| SMILES | Cc1ccc(-c2cc(-c3cc4ccccc4c4ccccc34)cc(C3N=C(c4ccccc4)NC(c4ccccc4)=N3)c2)c(C(C)(C)C)n1 |
| InChI | InChI=1S/C45H38N4/c1-29-23-24-37(41(46-29)45(2,3)4)33-25-34(40-28-32-19-11-12-20-36(32)38-21-13-14-22-39(38)40)27-35(26-33)44-48-42(30-15-7-5-8-16-30)47-43(49-44)31-17-9-6-10-18-31/h5-28,44H,1-4H3,(H,47,48,49) |
| InChIKey | WCGNDIMLCZMRIC-UHFFFAOYSA-N |
| XLogP | 10.82 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.83 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|