C18H17F3N2O4S — CID 155578559
4-[[2-(dimethylsulfamoyl)-5-ethenyl-3,4,6-trifluorophenoxy]methyl]benzamide (PubChem CID 155578559) has the molecular formula C18H17F3N2O4S and a molecular weight of 414.41 g/mol. Its IUPAC name is 4-[[2-(dimethylsulfamoyl)-5-ethenyl-3,4,6-trifluorophenoxy]methyl]benzamide.
| Compound Name | 4-[[2-(dimethylsulfamoyl)-5-ethenyl-3,4,6-trifluorophenoxy]methyl]benzamide |
|---|---|
| PubChem CID | 155578559 |
| Molecular Formula | C18H17F3N2O4S |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 4-[[2-(dimethylsulfamoyl)-5-ethenyl-3,4,6-trifluorophenoxy]methyl]benzamide |
| SMILES | C=Cc1c(F)c(F)c(S(=O)(=O)N(C)C)c(OCc2ccc(C(N)=O)cc2)c1F |
| InChI | InChI=1S/C18H17F3N2O4S/c1-4-12-13(19)15(21)17(28(25,26)23(2)3)16(14(12)20)27-9-10-5-7-11(8-6-10)18(22)24/h4-8H,1,9H2,2-3H3,(H2,22,24) |
| InChIKey | TWWQOVZJXYGFGV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|