C27H38ClN3O4S — CID 155579083
4-[2-[(5-chloro-2-propoxyphenyl)methyl-methylamino]ethyl]-N-prop-2-enylbenzenesulfonamide;pyrrolidine-2-carbaldehyde (PubChem CID 155579083) has the molecular formula C27H38ClN3O4S and a molecular weight of 536.14 g/mol. Its IUPAC name is 4-[2-[(5-chloro-2-propoxyphenyl)methyl-methylamino]ethyl]-N-prop-2-enylbenzenesulfonamide;pyrrolidine-2-carbaldehyde.
| Compound Name | 4-[2-[(5-chloro-2-propoxyphenyl)methyl-methylamino]ethyl]-N-prop-2-enylbenzenesulfonamide;pyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 155579083 |
| Molecular Formula | C27H38ClN3O4S |
| Molecular Weight | 536.14 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | 4-[2-[(5-chloro-2-propoxyphenyl)methyl-methylamino]ethyl]-N-prop-2-enylbenzenesulfonamide;pyrrolidine-2-carbaldehyde |
| SMILES | C=CCNS(=O)(=O)c1ccc(CCN(C)Cc2cc(Cl)ccc2OCCC)cc1.O=CC1CCCN1 |
| InChI | InChI=1S/C22H29ClN2O3S.C5H9NO/c1-4-13-24-29(26,27)21-9-6-18(7-10-21)12-14-25(3)17-19-16-20(23)8-11-22(19)28-15-5-2;7-4-5-2-1-3-6-5/h4,6-11,16,24H,1,5,12-15,17H2,2-3H3;4-6H,1-3H2 |
| InChIKey | BELJXXJEXWSVAK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.14 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|