C26H27ClN2O5S — CID 155533781
N-[(5-chloro-2-propoxyphenyl)methyl]-N-[2-[4-(prop-2-ynylsulfamoyl)phenyl]ethyl]furan-3-carboxamide (PubChem CID 155533781) has the molecular formula C26H27ClN2O5S and a molecular weight of 515.03 g/mol. Its IUPAC name is N-[(5-chloro-2-propoxyphenyl)methyl]-N-[2-[4-(prop-2-ynylsulfamoyl)phenyl]ethyl]furan-3-carboxamide.
| Compound Name | N-[(5-chloro-2-propoxyphenyl)methyl]-N-[2-[4-(prop-2-ynylsulfamoyl)phenyl]ethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 155533781 |
| Molecular Formula | C26H27ClN2O5S |
| Molecular Weight | 515.03 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | N-[(5-chloro-2-propoxyphenyl)methyl]-N-[2-[4-(prop-2-ynylsulfamoyl)phenyl]ethyl]furan-3-carboxamide |
| SMILES | C#CCNS(=O)(=O)c1ccc(CCN(Cc2cc(Cl)ccc2OCCC)C(=O)c2ccoc2)cc1 |
| InChI | InChI=1S/C26H27ClN2O5S/c1-3-13-28-35(31,32)24-8-5-20(6-9-24)11-14-29(26(30)21-12-16-33-19-21)18-22-17-23(27)7-10-25(22)34-15-4-2/h1,5-10,12,16-17,19,28H,4,11,13-15,18H2,2H3 |
| InChIKey | QFFCTFNSYVNQRC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.03 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|