C24H22ClN3O5S2 — CID 164848770
N-[(5-chloro-2-nitrophenyl)methyl]-N-[2-[4-(prop-2-ynylsulfamoyl)phenyl]ethyl]-2-thiophen-3-ylacetamide (PubChem CID 164848770) has the molecular formula C24H22ClN3O5S2 and a molecular weight of 532.04 g/mol. Its IUPAC name is N-[(5-chloro-2-nitrophenyl)methyl]-N-[2-[4-(prop-2-ynylsulfamoyl)phenyl]ethyl]-2-thiophen-3-ylacetamide.
| Compound Name | N-[(5-chloro-2-nitrophenyl)methyl]-N-[2-[4-(prop-2-ynylsulfamoyl)phenyl]ethyl]-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 164848770 |
| Molecular Formula | C24H22ClN3O5S2 |
| Molecular Weight | 532.04 g/mol |
| Exact Mass | 531.07 |
| IUPAC Name | N-[(5-chloro-2-nitrophenyl)methyl]-N-[2-[4-(prop-2-ynylsulfamoyl)phenyl]ethyl]-2-thiophen-3-ylacetamide |
| SMILES | C#CCNS(=O)(=O)c1ccc(CCN(Cc2cc(Cl)ccc2[N+](=O)[O-])C(=O)Cc2ccsc2)cc1 |
| InChI | InChI=1S/C24H22ClN3O5S2/c1-2-11-26-35(32,33)22-6-3-18(4-7-22)9-12-27(24(29)14-19-10-13-34-17-19)16-20-15-21(25)5-8-23(20)28(30)31/h1,3-8,10,13,15,17,26H,9,11-12,14,16H2 |
| InChIKey | PSCBXAMNXDCGEP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.04 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|