C25H25ClN4O5S2 — CID 164848783
(2S)-2-amino-N-[(5-chloro-2-nitrophenyl)methyl]-N-[2-[4-(prop-2-ynylsulfamoyl)phenyl]ethyl]-3-thiophen-2-ylpropanamide (PubChem CID 164848783) has the molecular formula C25H25ClN4O5S2 and a molecular weight of 561.09 g/mol. Its IUPAC name is (2S)-2-amino-N-[(5-chloro-2-nitrophenyl)methyl]-N-[2-[4-(prop-2-ynylsulfamoyl)phenyl]ethyl]-3-thiophen-2-ylpropanamide.
| Compound Name | (2S)-2-amino-N-[(5-chloro-2-nitrophenyl)methyl]-N-[2-[4-(prop-2-ynylsulfamoyl)phenyl]ethyl]-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 164848783 |
| Molecular Formula | C25H25ClN4O5S2 |
| Molecular Weight | 561.09 g/mol |
| Exact Mass | 560.10 |
| IUPAC Name | (2S)-2-amino-N-[(5-chloro-2-nitrophenyl)methyl]-N-[2-[4-(prop-2-ynylsulfamoyl)phenyl]ethyl]-3-thiophen-2-ylpropanamide |
| SMILES | C#CCNS(=O)(=O)c1ccc(CCN(Cc2cc(Cl)ccc2[N+](=O)[O-])C(=O)[C@@H](N)Cc2cccs2)cc1 |
| InChI | InChI=1S/C25H25ClN4O5S2/c1-2-12-28-37(34,35)22-8-5-18(6-9-22)11-13-29(25(31)23(27)16-21-4-3-14-36-21)17-19-15-20(26)7-10-24(19)30(32)33/h1,3-10,14-15,23,28H,11-13,16-17,27H2/t23-/m0/s1 |
| InChIKey | QRXMJNWYFDOHGU-QHCPKHFHSA-N |
| XLogP | 3.36 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.09 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|