C20H20N8O — CID 155581972
2-[[(3R)-1-[6-(1-hydroxyprop-2-enylamino)phthalazin-1-yl]pyrrolidin-3-yl]amino]pyrimidine-5-carbonitrile (PubChem CID 155581972) has the molecular formula C20H20N8O and a molecular weight of 388.44 g/mol. Its IUPAC name is 2-[[(3R)-1-[6-(1-hydroxyprop-2-enylamino)phthalazin-1-yl]pyrrolidin-3-yl]amino]pyrimidine-5-carbonitrile.
| Compound Name | 2-[[(3R)-1-[6-(1-hydroxyprop-2-enylamino)phthalazin-1-yl]pyrrolidin-3-yl]amino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 155581972 |
| Molecular Formula | C20H20N8O |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 2-[[(3R)-1-[6-(1-hydroxyprop-2-enylamino)phthalazin-1-yl]pyrrolidin-3-yl]amino]pyrimidine-5-carbonitrile |
| SMILES | C=CC(O)Nc1ccc2c(N3CC[C@@H](Nc4ncc(C#N)cn4)C3)nncc2c1 |
| InChI | InChI=1S/C20H20N8O/c1-2-18(29)25-15-3-4-17-14(7-15)11-24-27-19(17)28-6-5-16(12-28)26-20-22-9-13(8-21)10-23-20/h2-4,7,9-11,16,18,25,29H,1,5-6,12H2,(H,22,23,26)/t16-,18?/m1/s1 |
| InChIKey | BFZUDDNXDJJJKL-PYUWXLGESA-N |
| XLogP | 1.90 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|