C14H16BrN5OS — CID 91435883
1-[1-(6-bromophthalazin-1-yl)piperidin-4-yl]-3-sulfanylurea (PubChem CID 91435883) has the molecular formula C14H16BrN5OS and a molecular weight of 382.29 g/mol. Its IUPAC name is 1-[1-(6-bromophthalazin-1-yl)piperidin-4-yl]-3-sulfanylurea.
| Compound Name | 1-[1-(6-bromophthalazin-1-yl)piperidin-4-yl]-3-sulfanylurea |
|---|---|
| PubChem CID | 91435883 |
| Molecular Formula | C14H16BrN5OS |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | 1-[1-(6-bromophthalazin-1-yl)piperidin-4-yl]-3-sulfanylurea |
| SMILES | O=C(NS)NC1CCN(c2nncc3cc(Br)ccc23)CC1 |
| InChI | InChI=1S/C14H16BrN5OS/c15-10-1-2-12-9(7-10)8-16-18-13(12)20-5-3-11(4-6-20)17-14(21)19-22/h1-2,7-8,11,22H,3-6H2,(H2,17,19,21) |
| InChIKey | FQPXJCNUPXEAJO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|