C21H22BrN5S2 — CID 25027566
1-[1-(7-bromophthalazin-1-yl)piperidin-4-yl]-3-(4-methyl-2-sulfanylphenyl)thiourea (PubChem CID 25027566) has the molecular formula C21H22BrN5S2 and a molecular weight of 488.48 g/mol. Its IUPAC name is 1-[1-(7-bromophthalazin-1-yl)piperidin-4-yl]-3-(4-methyl-2-sulfanylphenyl)thiourea.
| Compound Name | 1-[1-(7-bromophthalazin-1-yl)piperidin-4-yl]-3-(4-methyl-2-sulfanylphenyl)thiourea |
|---|---|
| PubChem CID | 25027566 |
| Molecular Formula | C21H22BrN5S2 |
| Molecular Weight | 488.48 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | 1-[1-(7-bromophthalazin-1-yl)piperidin-4-yl]-3-(4-methyl-2-sulfanylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NC2CCN(c3nncc4ccc(Br)cc34)CC2)c(S)c1 |
| InChI | InChI=1S/C21H22BrN5S2/c1-13-2-5-18(19(28)10-13)25-21(29)24-16-6-8-27(9-7-16)20-17-11-15(22)4-3-14(17)12-23-26-20/h2-5,10-12,16,28H,6-9H2,1H3,(H2,24,25,29) |
| InChIKey | GGHBDGMKDZDLTG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|