C20H19Br2N5S — CID 25030779
1-(2-bromophenyl)-3-[1-(6-bromophthalazin-1-yl)piperidin-4-yl]thiourea (PubChem CID 25030779) has the molecular formula C20H19Br2N5S and a molecular weight of 521.28 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-[1-(6-bromophthalazin-1-yl)piperidin-4-yl]thiourea.
| Compound Name | 1-(2-bromophenyl)-3-[1-(6-bromophthalazin-1-yl)piperidin-4-yl]thiourea |
|---|---|
| PubChem CID | 25030779 |
| Molecular Formula | C20H19Br2N5S |
| Molecular Weight | 521.28 g/mol |
| Exact Mass | 518.97 |
| IUPAC Name | 1-(2-bromophenyl)-3-[1-(6-bromophthalazin-1-yl)piperidin-4-yl]thiourea |
| SMILES | S=C(Nc1ccccc1Br)NC1CCN(c2nncc3cc(Br)ccc23)CC1 |
| InChI | InChI=1S/C20H19Br2N5S/c21-14-5-6-16-13(11-14)12-23-26-19(16)27-9-7-15(8-10-27)24-20(28)25-18-4-2-1-3-17(18)22/h1-6,11-12,15H,7-10H2,(H2,24,25,28) |
| InChIKey | OHVAUTXECXETAS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.28 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|