C20H22F3N5O3 — CID 155582108
N-[4-(azetidin-1-yl)-1-pyrrolidin-1-ylphthalazin-6-yl]prop-2-enamide;2,2,2-trifluoroacetic acid (PubChem CID 155582108) has the molecular formula C20H22F3N5O3 and a molecular weight of 437.42 g/mol. Its IUPAC name is N-[4-(azetidin-1-yl)-1-pyrrolidin-1-ylphthalazin-6-yl]prop-2-enamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[4-(azetidin-1-yl)-1-pyrrolidin-1-ylphthalazin-6-yl]prop-2-enamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155582108 |
| Molecular Formula | C20H22F3N5O3 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N-[4-(azetidin-1-yl)-1-pyrrolidin-1-ylphthalazin-6-yl]prop-2-enamide;2,2,2-trifluoroacetic acid |
| SMILES | C=CC(=O)Nc1ccc2c(N3CCCC3)nnc(N3CCC3)c2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H21N5O.C2HF3O2/c1-2-16(24)19-13-6-7-14-15(12-13)18(23-10-5-11-23)21-20-17(14)22-8-3-4-9-22;3-2(4,5)1(6)7/h2,6-7,12H,1,3-5,8-11H2,(H,19,24);(H,6,7) |
| InChIKey | KVEVAQCBXDLZLZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|