C19H24N6O — CID 163288740
N-[4-[(3R)-3-aminopyrrolidin-1-yl]-2-pyrrolidin-1-ylquinazolin-7-yl]prop-2-enamide (PubChem CID 163288740) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is N-[4-[(3R)-3-aminopyrrolidin-1-yl]-2-pyrrolidin-1-ylquinazolin-7-yl]prop-2-enamide.
| Compound Name | N-[4-[(3R)-3-aminopyrrolidin-1-yl]-2-pyrrolidin-1-ylquinazolin-7-yl]prop-2-enamide |
|---|---|
| PubChem CID | 163288740 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | N-[4-[(3R)-3-aminopyrrolidin-1-yl]-2-pyrrolidin-1-ylquinazolin-7-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc2c(N3CC[C@@H](N)C3)nc(N3CCCC3)nc2c1 |
| InChI | InChI=1S/C19H24N6O/c1-2-17(26)21-14-5-6-15-16(11-14)22-19(24-8-3-4-9-24)23-18(15)25-10-7-13(20)12-25/h2,5-6,11,13H,1,3-4,7-10,12,20H2,(H,21,26)/t13-/m1/s1 |
| InChIKey | HWNLGRFJDMZBHR-CYBMUJFWSA-N |
| XLogP | 1.89 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|