C22H26F3N5O4 — CID 163288712
tert-butyl N-[(3R)-1-[7-(prop-2-enoylamino)-2-(2,2,2-trifluoroethoxy)quinazolin-4-yl]pyrrolidin-3-yl]carbamate (PubChem CID 163288712) has the molecular formula C22H26F3N5O4 and a molecular weight of 481.48 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[7-(prop-2-enoylamino)-2-(2,2,2-trifluoroethoxy)quinazolin-4-yl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[7-(prop-2-enoylamino)-2-(2,2,2-trifluoroethoxy)quinazolin-4-yl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 163288712 |
| Molecular Formula | C22H26F3N5O4 |
| Molecular Weight | 481.48 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | tert-butyl N-[(3R)-1-[7-(prop-2-enoylamino)-2-(2,2,2-trifluoroethoxy)quinazolin-4-yl]pyrrolidin-3-yl]carbamate |
| SMILES | C=CC(=O)Nc1ccc2c(N3CC[C@@H](NC(=O)OC(C)(C)C)C3)nc(OCC(F)(F)F)nc2c1 |
| InChI | InChI=1S/C22H26F3N5O4/c1-5-17(31)26-13-6-7-15-16(10-13)28-19(33-12-22(23,24)25)29-18(15)30-9-8-14(11-30)27-20(32)34-21(2,3)4/h5-7,10,14H,1,8-9,11-12H2,2-4H3,(H,26,31)(H,27,32)/t14-/m1/s1 |
| InChIKey | PSCQVTUVRJZYQE-CQSZACIVSA-N |
| XLogP | 3.80 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|