C22H28N4O3 — CID 163288765
tert-butyl N-[(3R)-1-[6-[[(E)-but-2-enoyl]amino]isoquinolin-1-yl]pyrrolidin-3-yl]carbamate (PubChem CID 163288765) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[6-[[(E)-but-2-enoyl]amino]isoquinolin-1-yl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[6-[[(E)-but-2-enoyl]amino]isoquinolin-1-yl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 163288765 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | tert-butyl N-[(3R)-1-[6-[[(E)-but-2-enoyl]amino]isoquinolin-1-yl]pyrrolidin-3-yl]carbamate |
| SMILES | C/C=C/C(=O)Nc1ccc2c(N3CC[C@@H](NC(=O)OC(C)(C)C)C3)nccc2c1 |
| InChI | InChI=1S/C22H28N4O3/c1-5-6-19(27)24-16-7-8-18-15(13-16)9-11-23-20(18)26-12-10-17(14-26)25-21(28)29-22(2,3)4/h5-9,11,13,17H,10,12,14H2,1-4H3,(H,24,27)(H,25,28)/b6-5+/t17-/m1/s1 |
| InChIKey | NOHHNCNCLDAYDE-FUTAKVPZSA-N |
| XLogP | 3.85 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|