C25H30N6O2 — CID 175728807
N-[4-(3-tert-butyl-2-formylpyrrol-1-yl)-2-(4-methylpiperazin-1-yl)quinazolin-7-yl]prop-2-enamide (PubChem CID 175728807) has the molecular formula C25H30N6O2 and a molecular weight of 446.56 g/mol. Its IUPAC name is N-[4-(3-tert-butyl-2-formylpyrrol-1-yl)-2-(4-methylpiperazin-1-yl)quinazolin-7-yl]prop-2-enamide.
| Compound Name | N-[4-(3-tert-butyl-2-formylpyrrol-1-yl)-2-(4-methylpiperazin-1-yl)quinazolin-7-yl]prop-2-enamide |
|---|---|
| PubChem CID | 175728807 |
| Molecular Formula | C25H30N6O2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | N-[4-(3-tert-butyl-2-formylpyrrol-1-yl)-2-(4-methylpiperazin-1-yl)quinazolin-7-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc2c(-n3ccc(C(C)(C)C)c3C=O)nc(N3CCN(C)CC3)nc2c1 |
| InChI | InChI=1S/C25H30N6O2/c1-6-22(33)26-17-7-8-18-20(15-17)27-24(30-13-11-29(5)12-14-30)28-23(18)31-10-9-19(21(31)16-32)25(2,3)4/h6-10,15-16H,1,11-14H2,2-5H3,(H,26,33) |
| InChIKey | CFJYRKNBDOWJIB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|