About N-isoquinolin-6-ylformamide;2-phenylpropan-1-amine
N-isoquinolin-6-ylformamide;2-phenylpropan-1-amine (PubChem CID 155582866) has the molecular formula C19H21N3O
and a molecular weight of 307.40 g/mol. Its IUPAC name is N-isoquinolin-6-ylformamide;2-phenylpropan-1-amine.
Molecular Properties
| Compound Name | N-isoquinolin-6-ylformamide;2-phenylpropan-1-amine |
| PubChem CID | 155582866 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | N-isoquinolin-6-ylformamide;2-phenylpropan-1-amine |
| SMILES | CC(CN)c1ccccc1.O=CNc1ccc2cnccc2c1 |
| InChI | InChI=1S/C10H8N2O.C9H13N/c13-7-12-10-2-1-9-6-11-4-3-8(9)5-10;1-8(7-10)9-5-3-2-4-6-9/h1-7H,(H,12,13);2-6,8H,7,10H2,1H3 |
| InChIKey | QGUNDBBUNMQYRY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-isoquinolin-6-ylformamide;2-phenylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-isoquinolin-6-ylformamide;2-phenylpropan-1-amine?
The IUPAC name of N-isoquinolin-6-ylformamide;2-phenylpropan-1-amine (CID 155582866) is N-isoquinolin-6-ylformamide;2-phenylpropan-1-amine.
What is the SMILES notation for N-isoquinolin-6-ylformamide;2-phenylpropan-1-amine?
The canonical SMILES for N-isoquinolin-6-ylformamide;2-phenylpropan-1-amine is CC(CN)c1ccccc1.O=CNc1ccc2cnccc2c1.
What is the InChIKey of N-isoquinolin-6-ylformamide;2-phenylpropan-1-amine?
The InChIKey is QGUNDBBUNMQYRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O.C9H13N/c13-7-12-10-2-1-9-6-11-4-3-8(9)5-10;1-8(7-10)9-5-3-2-4-6-9/h1-7H,(H,12,13);2-6,8H,7,10H2,1H3.
What are the key properties of N-isoquinolin-6-ylformamide;2-phenylpropan-1-amine?
N-isoquinolin-6-ylformamide;2-phenylpropan-1-amine has a molecular weight of 307.40 g/mol, XLogP of 3.55, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-isoquinolin-6-ylformamide;2-phenylpropan-1-amine is sourced from PubChem (CID 155582866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).