C18H14BrF3N4O — CID 155585880
1-(4-bromophenyl)-3-methyl-N'-[4-(trifluoromethoxy)phenyl]pyrazole-4-carboximidamide (PubChem CID 155585880) has the molecular formula C18H14BrF3N4O and a molecular weight of 439.24 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-methyl-N'-[4-(trifluoromethoxy)phenyl]pyrazole-4-carboximidamide.
| Compound Name | 1-(4-bromophenyl)-3-methyl-N'-[4-(trifluoromethoxy)phenyl]pyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 155585880 |
| Molecular Formula | C18H14BrF3N4O |
| Molecular Weight | 439.24 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | 1-(4-bromophenyl)-3-methyl-N'-[4-(trifluoromethoxy)phenyl]pyrazole-4-carboximidamide |
| SMILES | Cc1nn(-c2ccc(Br)cc2)cc1/C(N)=N/c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H14BrF3N4O/c1-11-16(10-26(25-11)14-6-2-12(19)3-7-14)17(23)24-13-4-8-15(9-5-13)27-18(20,21)22/h2-10H,1H3,(H2,23,24) |
| InChIKey | KSYOEPRCFITCNH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.24 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|