C10H8ClF3N2O2S — CID 155586677
N-(2-amino-2-oxoethyl)-3-chloro-5-(trifluoromethylsulfanyl)benzamide (PubChem CID 155586677) has the molecular formula C10H8ClF3N2O2S and a molecular weight of 312.70 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-3-chloro-5-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-3-chloro-5-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 155586677 |
| Molecular Formula | C10H8ClF3N2O2S |
| Molecular Weight | 312.70 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-3-chloro-5-(trifluoromethylsulfanyl)benzamide |
| SMILES | NC(=O)CNC(=O)c1cc(Cl)cc(SC(F)(F)F)c1 |
| InChI | InChI=1S/C10H8ClF3N2O2S/c11-6-1-5(9(18)16-4-8(15)17)2-7(3-6)19-10(12,13)14/h1-3H,4H2,(H2,15,17)(H,16,18) |
| InChIKey | JLBSJMSVPCURRK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.70 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |