C27H27N3O4 — CID 155592093
N-[3-[4-(2,6-dimethyl-4-prop-1-ynylphenyl)-3,5-dioxocyclohexyl]azetidine-1-carbonyl]pyridine-2-carboxamide (PubChem CID 155592093) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is N-[3-[4-(2,6-dimethyl-4-prop-1-ynylphenyl)-3,5-dioxocyclohexyl]azetidine-1-carbonyl]pyridine-2-carboxamide.
| Compound Name | N-[3-[4-(2,6-dimethyl-4-prop-1-ynylphenyl)-3,5-dioxocyclohexyl]azetidine-1-carbonyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155592093 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | N-[3-[4-(2,6-dimethyl-4-prop-1-ynylphenyl)-3,5-dioxocyclohexyl]azetidine-1-carbonyl]pyridine-2-carboxamide |
| SMILES | CC#Cc1cc(C)c(C2C(=O)CC(C3CN(C(=O)NC(=O)c4ccccn4)C3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C27H27N3O4/c1-4-7-18-10-16(2)24(17(3)11-18)25-22(31)12-19(13-23(25)32)20-14-30(15-20)27(34)29-26(33)21-8-5-6-9-28-21/h5-6,8-11,19-20,25H,12-15H2,1-3H3,(H,29,33,34) |
| InChIKey | LDYAGIMASMRMGQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|