C18H19N3O3S2 — CID 155595873
4-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]oxythieno[3,2-d]pyrimidine (PubChem CID 155595873) has the molecular formula C18H19N3O3S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 4-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]oxythieno[3,2-d]pyrimidine.
| Compound Name | 4-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]oxythieno[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 155595873 |
| Molecular Formula | C18H19N3O3S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 4-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]oxythieno[3,2-d]pyrimidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(Oc3ncnc4ccsc34)CC2)cc1 |
| InChI | InChI=1S/C18H19N3O3S2/c1-13-2-4-15(5-3-13)26(22,23)21-9-6-14(7-10-21)24-18-17-16(8-11-25-17)19-12-20-18/h2-5,8,11-12,14H,6-7,9-10H2,1H3 |
| InChIKey | QDRLPLWIBHNYNB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |