C23H21N3O4S2 — CID 163405561
4-[1-(3-phenoxyphenyl)sulfonylpiperidin-4-yl]oxythieno[3,2-d]pyrimidine (PubChem CID 163405561) has the molecular formula C23H21N3O4S2 and a molecular weight of 467.57 g/mol. Its IUPAC name is 4-[1-(3-phenoxyphenyl)sulfonylpiperidin-4-yl]oxythieno[3,2-d]pyrimidine.
| Compound Name | 4-[1-(3-phenoxyphenyl)sulfonylpiperidin-4-yl]oxythieno[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 163405561 |
| Molecular Formula | C23H21N3O4S2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | 4-[1-(3-phenoxyphenyl)sulfonylpiperidin-4-yl]oxythieno[3,2-d]pyrimidine |
| SMILES | O=S(=O)(c1cccc(Oc2ccccc2)c1)N1CCC(Oc2ncnc3ccsc23)CC1 |
| InChI | InChI=1S/C23H21N3O4S2/c27-32(28,20-8-4-7-19(15-20)29-17-5-2-1-3-6-17)26-12-9-18(10-13-26)30-23-22-21(11-14-31-22)24-16-25-23/h1-8,11,14-16,18H,9-10,12-13H2 |
| InChIKey | ZPUDYFIURLZBHL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |