C25H34BrN3O3 — CID 155600734
tert-butyl 4-[2-[1-(4-bromoanilino)-4-hydroxybutyl]phenyl]piperazine-1-carboxylate (PubChem CID 155600734) has the molecular formula C25H34BrN3O3 and a molecular weight of 504.47 g/mol. Its IUPAC name is tert-butyl 4-[2-[1-(4-bromoanilino)-4-hydroxybutyl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[1-(4-bromoanilino)-4-hydroxybutyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 155600734 |
| Molecular Formula | C25H34BrN3O3 |
| Molecular Weight | 504.47 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | tert-butyl 4-[2-[1-(4-bromoanilino)-4-hydroxybutyl]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccccc2C(CCCO)Nc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C25H34BrN3O3/c1-25(2,3)32-24(31)29-16-14-28(15-17-29)23-9-5-4-7-21(23)22(8-6-18-30)27-20-12-10-19(26)11-13-20/h4-5,7,9-13,22,27,30H,6,8,14-18H2,1-3H3 |
| InChIKey | QWAQSWSVZISHFM-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.47 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |