C62H62N4O2Pt — CID 155610040
3-(3,6-ditert-butylcarbazol-9-yl)-8-[[6-[4-(3,6-ditert-butylcarbazol-9-yl)-2-hydroxyphenyl]-2-pyridinyl]methylideneamino]naphthalen-1-ol;platinum (PubChem CID 155610040) has the molecular formula C62H62N4O2Pt and a molecular weight of 1090.28 g/mol. Its IUPAC name is 3-(3,6-ditert-butylcarbazol-9-yl)-8-[[6-[4-(3,6-ditert-butylcarbazol-9-yl)-2-hydroxyphenyl]-2-pyridinyl]methylideneamino]naphthalen-1-ol;platinum.
| Compound Name | 3-(3,6-ditert-butylcarbazol-9-yl)-8-[[6-[4-(3,6-ditert-butylcarbazol-9-yl)-2-hydroxyphenyl]-2-pyridinyl]methylideneamino]naphthalen-1-ol;platinum |
|---|---|
| PubChem CID | 155610040 |
| Molecular Formula | C62H62N4O2Pt |
| Molecular Weight | 1090.28 g/mol |
| Exact Mass | 1089.45 |
| IUPAC Name | 3-(3,6-ditert-butylcarbazol-9-yl)-8-[[6-[4-(3,6-ditert-butylcarbazol-9-yl)-2-hydroxyphenyl]-2-pyridinyl]methylideneamino]naphthalen-1-ol;platinum |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1ccc(-c2cccc(/C=N/c3cccc4cc(-n5c6ccc(C(C)(C)C)cc6c6cc(C(C)(C)C)ccc65)cc(O)c34)n2)c(O)c1.[Pt] |
| InChI | InChI=1S/C62H62N4O2.Pt/c1-59(2,3)38-19-25-52-46(30-38)47-31-39(60(4,5)6)20-26-53(47)65(52)43-23-24-45(56(67)34-43)50-17-14-16-42(64-50)36-63-51-18-13-15-37-29-44(35-57(68)58(37)51)66-54-27-21-40(61(7,8)9)32-48(54)49-33-41(62(10,11)12)22-28-55(49)66;/h13-36,67-68H,1-12H3;/b63-36+; |
| InChIKey | IXXYGUHBUSCTMO-UHWTWMLRSA-N |
| XLogP | 16.45 |
| TPSA | 75.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1090.28 |
| LogP ≤ 5 | 16.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|