C46H43IrN5-2 — CID 155613273
3-benzyl-5-phenyl-4-[4-phenyl-2,6-di(propan-2-yl)phenyl]-1,2,4-triazole;5,6-dimethyl-10H-imidazo[2,1-a]isoquinolin-10-ide;iridium (PubChem CID 155613273) has the molecular formula C46H43IrN5-2 and a molecular weight of 858.10 g/mol. Its IUPAC name is 3-benzyl-5-phenyl-4-[4-phenyl-2,6-di(propan-2-yl)phenyl]-1,2,4-triazole;5,6-dimethyl-10H-imidazo[2,1-a]isoquinolin-10-ide;iridium.
| Compound Name | 3-benzyl-5-phenyl-4-[4-phenyl-2,6-di(propan-2-yl)phenyl]-1,2,4-triazole;5,6-dimethyl-10H-imidazo[2,1-a]isoquinolin-10-ide;iridium |
|---|---|
| PubChem CID | 155613273 |
| Molecular Formula | C46H43IrN5-2 |
| Molecular Weight | 858.10 g/mol |
| Exact Mass | 858.32 |
| IUPAC Name | 3-benzyl-5-phenyl-4-[4-phenyl-2,6-di(propan-2-yl)phenyl]-1,2,4-triazole;5,6-dimethyl-10H-imidazo[2,1-a]isoquinolin-10-ide;iridium |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1c(Cc2ccccc2)nnc1-c1[c-]cccc1.Cc1c(C)n2ccnc2c2[c-]cccc12.[Ir] |
| InChI | InChI=1S/C33H32N3.C13H11N2.Ir/c1-23(2)29-21-28(26-16-10-6-11-17-26)22-30(24(3)4)32(29)36-31(20-25-14-8-5-9-15-25)34-35-33(36)27-18-12-7-13-19-27;1-9-10(2)15-8-7-14-13(15)12-6-4-3-5-11(9)12;/h5-18,21-24H,20H2,1-4H3;3-5,7-8H,1-2H3;/q2*-1; |
| InChIKey | NKJBLBNKXGWMKZ-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 48.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.10 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|