C22H39N3S — CID 155613541
(2R)-4-[4-(3-methylbutyl)piperazin-1-yl]-1-phenylsulfanyl-N-propan-2-ylbutan-2-amine (PubChem CID 155613541) has the molecular formula C22H39N3S and a molecular weight of 377.64 g/mol. Its IUPAC name is (2R)-4-[4-(3-methylbutyl)piperazin-1-yl]-1-phenylsulfanyl-N-propan-2-ylbutan-2-amine.
| Compound Name | (2R)-4-[4-(3-methylbutyl)piperazin-1-yl]-1-phenylsulfanyl-N-propan-2-ylbutan-2-amine |
|---|---|
| PubChem CID | 155613541 |
| Molecular Formula | C22H39N3S |
| Molecular Weight | 377.64 g/mol |
| Exact Mass | 377.29 |
| IUPAC Name | (2R)-4-[4-(3-methylbutyl)piperazin-1-yl]-1-phenylsulfanyl-N-propan-2-ylbutan-2-amine |
| SMILES | CC(C)CCN1CCN(CC[C@H](CSc2ccccc2)NC(C)C)CC1 |
| InChI | InChI=1S/C22H39N3S/c1-19(2)10-12-24-14-16-25(17-15-24)13-11-21(23-20(3)4)18-26-22-8-6-5-7-9-22/h5-9,19-21,23H,10-18H2,1-4H3/t21-/m1/s1 |
| InChIKey | IYSUWVRUIWKYLG-OAQYLSRUSA-N |
| XLogP | 4.20 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.64 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |