C24H42N3O5PS — CID 129270255
tert-butyl N-[(2R)-4-[4-(diethoxyphosphorylmethyl)piperazin-1-yl]-1-phenylsulfanylbutan-2-yl]carbamate (PubChem CID 129270255) has the molecular formula C24H42N3O5PS and a molecular weight of 515.66 g/mol. Its IUPAC name is tert-butyl N-[(2R)-4-[4-(diethoxyphosphorylmethyl)piperazin-1-yl]-1-phenylsulfanylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-4-[4-(diethoxyphosphorylmethyl)piperazin-1-yl]-1-phenylsulfanylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 129270255 |
| Molecular Formula | C24H42N3O5PS |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | tert-butyl N-[(2R)-4-[4-(diethoxyphosphorylmethyl)piperazin-1-yl]-1-phenylsulfanylbutan-2-yl]carbamate |
| SMILES | CCOP(=O)(CN1CCN(CC[C@H](CSc2ccccc2)NC(=O)OC(C)(C)C)CC1)OCC |
| InChI | InChI=1S/C24H42N3O5PS/c1-6-30-33(29,31-7-2)20-27-17-15-26(16-18-27)14-13-21(25-23(28)32-24(3,4)5)19-34-22-11-9-8-10-12-22/h8-12,21H,6-7,13-20H2,1-5H3,(H,25,28)/t21-/m1/s1 |
| InChIKey | MOAXMPPDWYVNCX-OAQYLSRUSA-N |
| XLogP | 4.90 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|