C13H27INO5PS — CID 59776557
tert-butyl N-[(2S)-1-(diethoxyphosphorylmethylsulfanyl)-3-iodopropan-2-yl]carbamate (PubChem CID 59776557) has the molecular formula C13H27INO5PS and a molecular weight of 467.31 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(diethoxyphosphorylmethylsulfanyl)-3-iodopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(diethoxyphosphorylmethylsulfanyl)-3-iodopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 59776557 |
| Molecular Formula | C13H27INO5PS |
| Molecular Weight | 467.31 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | tert-butyl N-[(2S)-1-(diethoxyphosphorylmethylsulfanyl)-3-iodopropan-2-yl]carbamate |
| SMILES | CCOP(=O)(CSC[C@@H](CI)NC(=O)OC(C)(C)C)OCC |
| InChI | InChI=1S/C13H27INO5PS/c1-6-18-21(17,19-7-2)10-22-9-11(8-14)15-12(16)20-13(3,4)5/h11H,6-10H2,1-5H3,(H,15,16)/t11-/m1/s1 |
| InChIKey | FFTPSEYHFAWYQQ-LLVKDONJSA-N |
| XLogP | 4.27 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|