C18H27NO3S — CID 166937887
tert-butyl N-[(E,2R)-6-methoxy-1-phenylsulfanylhex-5-en-2-yl]carbamate (PubChem CID 166937887) has the molecular formula C18H27NO3S and a molecular weight of 337.49 g/mol. Its IUPAC name is tert-butyl N-[(E,2R)-6-methoxy-1-phenylsulfanylhex-5-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E,2R)-6-methoxy-1-phenylsulfanylhex-5-en-2-yl]carbamate |
|---|---|
| PubChem CID | 166937887 |
| Molecular Formula | C18H27NO3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | tert-butyl N-[(E,2R)-6-methoxy-1-phenylsulfanylhex-5-en-2-yl]carbamate |
| SMILES | CO/C=C/CC[C@H](CSc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27NO3S/c1-18(2,3)22-17(20)19-15(10-8-9-13-21-4)14-23-16-11-6-5-7-12-16/h5-7,9,11-13,15H,8,10,14H2,1-4H3,(H,19,20)/b13-9+/t15-/m1/s1 |
| InChIKey | DVTHODPOSPXFCV-BMQCOBNYSA-N |
| XLogP | 4.61 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|