C15H15FN4O — CID 155614031
2-(2-(18F)fluoro-5-methylpyrrolo[3,2-d]pyrimidin-4-yl)-4-methoxy-N-methyl(18F)aniline (PubChem CID 155614031) has the molecular formula C15H15FN4O and a molecular weight of 285.31 g/mol. Its IUPAC name is 2-(2-(18F)fluoro-5-methylpyrrolo[3,2-d]pyrimidin-4-yl)-4-methoxy-N-methyl(18F)aniline.
| Compound Name | 2-(2-(18F)fluoro-5-methylpyrrolo[3,2-d]pyrimidin-4-yl)-4-methoxy-N-methyl(18F)aniline |
|---|---|
| PubChem CID | 155614031 |
| Molecular Formula | C15H15FN4O |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 2-(2-(18F)fluoro-5-methylpyrrolo[3,2-d]pyrimidin-4-yl)-4-methoxy-N-methyl(18F)aniline |
| SMILES | CNc1ccc(OC)cc1-c1nc([18F])nc2ccn(C)c12 |
| InChI | InChI=1S/C15H15FN4O/c1-17-11-5-4-9(21-3)8-10(11)13-14-12(6-7-20(14)2)18-15(16)19-13/h4-8,17H,1-3H3/i16-1 |
| InChIKey | FYWPBFOLSMNEQA-GKTGUEEDSA-N |
| XLogP | 2.82 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|