C21H37NO2Si — CID 155614627
[di(butan-2-yl)-tert-butylsilyl] (2S)-2-amino-3-phenylpropanoate (PubChem CID 155614627) has the molecular formula C21H37NO2Si and a molecular weight of 363.62 g/mol. Its IUPAC name is [di(butan-2-yl)-tert-butylsilyl] (2S)-2-amino-3-phenylpropanoate.
| Compound Name | [di(butan-2-yl)-tert-butylsilyl] (2S)-2-amino-3-phenylpropanoate |
|---|---|
| PubChem CID | 155614627 |
| Molecular Formula | C21H37NO2Si |
| Molecular Weight | 363.62 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | [di(butan-2-yl)-tert-butylsilyl] (2S)-2-amino-3-phenylpropanoate |
| SMILES | CCC(C)[Si](OC(=O)[C@@H](N)Cc1ccccc1)(C(C)CC)C(C)(C)C |
| InChI | InChI=1S/C21H37NO2Si/c1-8-16(3)25(17(4)9-2,21(5,6)7)24-20(23)19(22)15-18-13-11-10-12-14-18/h10-14,16-17,19H,8-9,15,22H2,1-7H3/t16?,17?,19-,25?/m0/s1 |
| InChIKey | YVQXLKSVBHWHIL-PWQGACMJSA-N |
| XLogP | 5.45 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.62 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|