C12H21N3O — CID 155620556
(1S)-2-(tert-butylamino)-1-[6-(trideuteriomethylamino)-2-pyridinyl]ethanol (PubChem CID 155620556) has the molecular formula C12H21N3O and a molecular weight of 226.34 g/mol. Its IUPAC name is (1S)-2-(tert-butylamino)-1-[6-(trideuteriomethylamino)-2-pyridinyl]ethanol.
| Compound Name | (1S)-2-(tert-butylamino)-1-[6-(trideuteriomethylamino)-2-pyridinyl]ethanol |
|---|---|
| PubChem CID | 155620556 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | (1S)-2-(tert-butylamino)-1-[6-(trideuteriomethylamino)-2-pyridinyl]ethanol |
| SMILES | [2H]C([2H])([2H])Nc1cccc([C@@H](O)CNC(C)(C)C)n1 |
| InChI | InChI=1S/C12H21N3O/c1-12(2,3)14-8-10(16)9-6-5-7-11(13-4)15-9/h5-7,10,14,16H,8H2,1-4H3,(H,13,15)/t10-/m0/s1/i4D3 |
| InChIKey | UWOCCMLOSVFLNG-KDSJRMBXSA-N |
| XLogP | 1.54 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |