C15H27N3OS — CID 158367640
(1S)-2-(tert-butylamino)-1-(6-pyrrolidin-1-yl-2-pyridinyl)ethanol;sulfane (PubChem CID 158367640) has the molecular formula C15H27N3OS and a molecular weight of 297.47 g/mol. Its IUPAC name is (1S)-2-(tert-butylamino)-1-(6-pyrrolidin-1-yl-2-pyridinyl)ethanol;sulfane.
| Compound Name | (1S)-2-(tert-butylamino)-1-(6-pyrrolidin-1-yl-2-pyridinyl)ethanol;sulfane |
|---|---|
| PubChem CID | 158367640 |
| Molecular Formula | C15H27N3OS |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | (1S)-2-(tert-butylamino)-1-(6-pyrrolidin-1-yl-2-pyridinyl)ethanol;sulfane |
| SMILES | CC(C)(C)NC[C@H](O)c1cccc(N2CCCC2)n1.S |
| InChI | InChI=1S/C15H25N3O.H2S/c1-15(2,3)16-11-13(19)12-7-6-8-14(17-12)18-9-4-5-10-18;/h6-8,13,16,19H,4-5,9-11H2,1-3H3;1H2/t13-;/m0./s1 |
| InChIKey | GUFMFWPXVAYFTO-ZOWNYOTGSA-N |
| XLogP | 2.22 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |