About (1S)-2-(tert-butylamino)-1-(6-pyrrolidin-1-yl-2-pyridinyl)ethanol;sulfane
(1S)-2-(tert-butylamino)-1-(6-pyrrolidin-1-yl-2-pyridinyl)ethanol;sulfane (PubChem CID 158367640) has the molecular formula C15H27N3OS
and a molecular weight of 297.47 g/mol. Its IUPAC name is (1S)-2-(tert-butylamino)-1-(6-pyrrolidin-1-yl-2-pyridinyl)ethanol;sulfane.
Molecular Properties
| Compound Name | (1S)-2-(tert-butylamino)-1-(6-pyrrolidin-1-yl-2-pyridinyl)ethanol;sulfane |
| PubChem CID | 158367640 |
| Molecular Formula | C15H27N3OS |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | (1S)-2-(tert-butylamino)-1-(6-pyrrolidin-1-yl-2-pyridinyl)ethanol;sulfane |
| SMILES | CC(C)(C)NC[C@H](O)c1cccc(N2CCCC2)n1.S |
| InChI | InChI=1S/C15H25N3O.H2S/c1-15(2,3)16-11-13(19)12-7-6-8-14(17-12)18-9-4-5-10-18;/h6-8,13,16,19H,4-5,9-11H2,1-3H3;1H2/t13-;/m0./s1 |
| InChIKey | GUFMFWPXVAYFTO-ZOWNYOTGSA-N |
| XLogP | 2.22 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S)-2-(tert-butylamino)-1-(6-pyrrolidin-1-yl-2-pyridinyl)ethanol;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-2-(tert-butylamino)-1-(6-pyrrolidin-1-yl-2-pyridinyl)ethanol;sulfane?
The IUPAC name of (1S)-2-(tert-butylamino)-1-(6-pyrrolidin-1-yl-2-pyridinyl)ethanol;sulfane (CID 158367640) is (1S)-2-(tert-butylamino)-1-(6-pyrrolidin-1-yl-2-pyridinyl)ethanol;sulfane.
What is the SMILES notation for (1S)-2-(tert-butylamino)-1-(6-pyrrolidin-1-yl-2-pyridinyl)ethanol;sulfane?
The canonical SMILES for (1S)-2-(tert-butylamino)-1-(6-pyrrolidin-1-yl-2-pyridinyl)ethanol;sulfane is CC(C)(C)NC[C@H](O)c1cccc(N2CCCC2)n1.S.
What is the InChIKey of (1S)-2-(tert-butylamino)-1-(6-pyrrolidin-1-yl-2-pyridinyl)ethanol;sulfane?
The InChIKey is GUFMFWPXVAYFTO-ZOWNYOTGSA-N. The full InChI is InChI=1S/C15H25N3O.H2S/c1-15(2,3)16-11-13(19)12-7-6-8-14(17-12)18-9-4-5-10-18;/h6-8,13,16,19H,4-5,9-11H2,1-3H3;1H2/t13-;/m0./s1.
What are the key properties of (1S)-2-(tert-butylamino)-1-(6-pyrrolidin-1-yl-2-pyridinyl)ethanol;sulfane?
(1S)-2-(tert-butylamino)-1-(6-pyrrolidin-1-yl-2-pyridinyl)ethanol;sulfane has a molecular weight of 297.47 g/mol, XLogP of 2.22, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-2-(tert-butylamino)-1-(6-pyrrolidin-1-yl-2-pyridinyl)ethanol;sulfane is sourced from PubChem (CID 158367640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).