C47H47F3IrNO2- — CID 155620637
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;1-(3,5-dimethylbenzene-6-id-1-yl)-6-(2-phenylphenyl)-8-(trifluoromethyl)benzo[h]isoquinoline;iridium (PubChem CID 155620637) has the molecular formula C47H47F3IrNO2- and a molecular weight of 907.11 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;1-(3,5-dimethylbenzene-6-id-1-yl)-6-(2-phenylphenyl)-8-(trifluoromethyl)benzo[h]isoquinoline;iridium.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;1-(3,5-dimethylbenzene-6-id-1-yl)-6-(2-phenylphenyl)-8-(trifluoromethyl)benzo[h]isoquinoline;iridium |
|---|---|
| PubChem CID | 155620637 |
| Molecular Formula | C47H47F3IrNO2- |
| Molecular Weight | 907.11 g/mol |
| Exact Mass | 907.32 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;1-(3,5-dimethylbenzene-6-id-1-yl)-6-(2-phenylphenyl)-8-(trifluoromethyl)benzo[h]isoquinoline;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1[c-]c(-c2nccc3cc(-c4ccccc4-c4ccccc4)c4cc(C(F)(F)F)ccc4c23)cc(C)c1.[Ir] |
| InChI | InChI=1S/C34H23F3N.C13H24O2.Ir/c1-21-16-22(2)18-25(17-21)33-32-24(14-15-38-33)19-30(31-20-26(34(35,36)37)12-13-29(31)32)28-11-7-6-10-27(28)23-8-4-3-5-9-23;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h3-17,19-20H,1-2H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | SVQXHVPWCUUTKV-DZTQYQPZSA-N |
| XLogP | 13.69 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.11 |
| LogP ≤ 5 | 13.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|