C14H11ClN6S — CID 155621182
2-N'-(1,3-benzothiazol-2-yl)-6-chloropyridine-2,3-dicarboximidamide (PubChem CID 155621182) has the molecular formula C14H11ClN6S and a molecular weight of 330.80 g/mol. Its IUPAC name is 2-N'-(1,3-benzothiazol-2-yl)-6-chloropyridine-2,3-dicarboximidamide.
| Compound Name | 2-N'-(1,3-benzothiazol-2-yl)-6-chloropyridine-2,3-dicarboximidamide |
|---|---|
| PubChem CID | 155621182 |
| Molecular Formula | C14H11ClN6S |
| Molecular Weight | 330.80 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 2-N'-(1,3-benzothiazol-2-yl)-6-chloropyridine-2,3-dicarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Cl)nc1/C(N)=N/c1nc2ccccc2s1 |
| InChI | InChI=1S/C14H11ClN6S/c15-10-6-5-7(12(16)17)11(20-10)13(18)21-14-19-8-3-1-2-4-9(8)22-14/h1-6H,(H3,16,17)(H2,18,19,21) |
| InChIKey | YNADBNNYKBJELO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 114.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.80 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|